About pentane;tritert-butylphosphane
pentane;tritert-butylphosphane (PubChem CID 175086214) has the molecular formula C17H39P
and a molecular weight of 274.47 g/mol. Its IUPAC name is pentane;tritert-butylphosphane.
Molecular Properties
| Compound Name | pentane;tritert-butylphosphane |
| PubChem CID | 175086214 |
| Molecular Formula | C17H39P |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.28 |
| IUPAC Name | pentane;tritert-butylphosphane |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.CCCCC |
| InChI | InChI=1S/C12H27P.C5H12/c1-10(2,3)13(11(4,5)6)12(7,8)9;1-3-5-4-2/h1-9H3;3-5H2,1-2H3 |
| InChIKey | MEUYEPFNAMJWEK-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentane;tritert-butylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane;tritert-butylphosphane?
The IUPAC name of pentane;tritert-butylphosphane (CID 175086214) is pentane;tritert-butylphosphane.
What is the SMILES notation for pentane;tritert-butylphosphane?
The canonical SMILES for pentane;tritert-butylphosphane is CC(C)(C)P(C(C)(C)C)C(C)(C)C.CCCCC.
What is the InChIKey of pentane;tritert-butylphosphane?
The InChIKey is MEUYEPFNAMJWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P.C5H12/c1-10(2,3)13(11(4,5)6)12(7,8)9;1-3-5-4-2/h1-9H3;3-5H2,1-2H3.
What are the key properties of pentane;tritert-butylphosphane?
pentane;tritert-butylphosphane has a molecular weight of 274.47 g/mol, XLogP of 7.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentane;tritert-butylphosphane is sourced from PubChem (CID 175086214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).