About palladium;tritert-butylphosphane;bromide
palladium;tritert-butylphosphane;bromide (PubChem CID 71317307) has the molecular formula C12H27BrPPd-
and a molecular weight of 388.65 g/mol. Its IUPAC name is palladium;tritert-butylphosphane;bromide.
Molecular Properties
| Compound Name | palladium;tritert-butylphosphane;bromide |
| PubChem CID | 71317307 |
| Molecular Formula | C12H27BrPPd- |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | palladium;tritert-butylphosphane;bromide |
| SMILES | CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Br-].[Pd] |
| InChI | InChI=1S/C12H27P.BrH.Pd/c1-10(2,3)13(11(4,5)6)12(7,8)9;;/h1-9H3;1H;/p-1 |
| InChIKey | WIADNXKBAGKNOT-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium;tritert-butylphosphane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;tritert-butylphosphane;bromide?
The IUPAC name of palladium;tritert-butylphosphane;bromide (CID 71317307) is palladium;tritert-butylphosphane;bromide.
What is the SMILES notation for palladium;tritert-butylphosphane;bromide?
The canonical SMILES for palladium;tritert-butylphosphane;bromide is CC(C)(C)P(C(C)(C)C)C(C)(C)C.[Br-].[Pd].
What is the InChIKey of palladium;tritert-butylphosphane;bromide?
The InChIKey is WIADNXKBAGKNOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27P.BrH.Pd/c1-10(2,3)13(11(4,5)6)12(7,8)9;;/h1-9H3;1H;/p-1.
What are the key properties of palladium;tritert-butylphosphane;bromide?
palladium;tritert-butylphosphane;bromide has a molecular weight of 388.65 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;tritert-butylphosphane;bromide is sourced from PubChem (CID 71317307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).