C34H74P4 — CID 18386849
dibutyl-[1,2,2-tris(dibutylphosphanyl)ethyl]phosphane (PubChem CID 18386849) has the molecular formula C34H74P4 and a molecular weight of 606.86 g/mol. Its IUPAC name is dibutyl-[1,2,2-tris(dibutylphosphanyl)ethyl]phosphane.
| Compound Name | dibutyl-[1,2,2-tris(dibutylphosphanyl)ethyl]phosphane |
|---|---|
| PubChem CID | 18386849 |
| Molecular Formula | C34H74P4 |
| Molecular Weight | 606.86 g/mol |
| Exact Mass | 606.47 |
| IUPAC Name | dibutyl-[1,2,2-tris(dibutylphosphanyl)ethyl]phosphane |
| SMILES | CCCCP(CCCC)C(C(P(CCCC)CCCC)P(CCCC)CCCC)P(CCCC)CCCC |
| InChI | InChI=1S/C34H74P4/c1-9-17-25-35(26-18-10-2)33(36(27-19-11-3)28-20-12-4)34(37(29-21-13-5)30-22-14-6)38(31-23-15-7)32-24-16-8/h33-34H,9-32H2,1-8H3 |
| InChIKey | OQGLTLJOOMDERO-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.86 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|