C13H24O2 — CID 101437056
(E,2R)-2-[(1R)-1-ethoxyethyl]-2-methyloct-3-enal (PubChem CID 101437056) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (E,2R)-2-[(1R)-1-ethoxyethyl]-2-methyloct-3-enal.
| Compound Name | (E,2R)-2-[(1R)-1-ethoxyethyl]-2-methyloct-3-enal |
|---|---|
| PubChem CID | 101437056 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (E,2R)-2-[(1R)-1-ethoxyethyl]-2-methyloct-3-enal |
| SMILES | CCCC/C=C/[C@@](C)(C=O)[C@@H](C)OCC |
| InChI | InChI=1S/C13H24O2/c1-5-7-8-9-10-13(4,11-14)12(3)15-6-2/h9-12H,5-8H2,1-4H3/b10-9+/t12-,13+/m1/s1 |
| InChIKey | NOSRMQVRRRYRDR-GBYBRZQVSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|