C15H28O2 — CID 126703602
methyl (E)-2,2,4,4-tetramethyldec-5-enoate (PubChem CID 126703602) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is methyl (E)-2,2,4,4-tetramethyldec-5-enoate.
| Compound Name | methyl (E)-2,2,4,4-tetramethyldec-5-enoate |
|---|---|
| PubChem CID | 126703602 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | methyl (E)-2,2,4,4-tetramethyldec-5-enoate |
| SMILES | CCCC/C=C/C(C)(C)CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H28O2/c1-7-8-9-10-11-14(2,3)12-15(4,5)13(16)17-6/h10-11H,7-9,12H2,1-6H3/b11-10+ |
| InChIKey | BREXBGPFIMATGO-ZHACJKMWSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|