C21H36O3 — CID 156679884
methyl (9E,11E)-2,2-dimethyl-13-oxooctadeca-9,11-dienoate (PubChem CID 156679884) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is methyl (9E,11E)-2,2-dimethyl-13-oxooctadeca-9,11-dienoate.
| Compound Name | methyl (9E,11E)-2,2-dimethyl-13-oxooctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 156679884 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | methyl (9E,11E)-2,2-dimethyl-13-oxooctadeca-9,11-dienoate |
| SMILES | CCCCCC(=O)/C=C/C=C/CCCCCCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C21H36O3/c1-5-6-13-16-19(22)17-14-11-9-7-8-10-12-15-18-21(2,3)20(23)24-4/h9,11,14,17H,5-8,10,12-13,15-16,18H2,1-4H3/b11-9+,17-14+ |
| InChIKey | BRXIMHUQKSOJAP-XILAHJMDSA-N |
| XLogP | 5.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|