About diethoxymethylsilane;propane
diethoxymethylsilane;propane (PubChem CID 174925754) has the molecular formula C8H22O2Si
and a molecular weight of 178.35 g/mol. Its IUPAC name is diethoxymethylsilane;propane.
Molecular Properties
| Compound Name | diethoxymethylsilane;propane |
| PubChem CID | 174925754 |
| Molecular Formula | C8H22O2Si |
| Molecular Weight | 178.35 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | diethoxymethylsilane;propane |
| SMILES | CCC.CCOC([SiH3])OCC |
| InChI | InChI=1S/C5H14O2Si.C3H8/c1-3-6-5(8)7-4-2;1-3-2/h5H,3-4H2,1-2,8H3;3H2,1-2H3 |
| InChIKey | NNUWZPROQWXQIN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethoxymethylsilane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxymethylsilane;propane?
The IUPAC name of diethoxymethylsilane;propane (CID 174925754) is diethoxymethylsilane;propane.
What is the SMILES notation for diethoxymethylsilane;propane?
The canonical SMILES for diethoxymethylsilane;propane is CCC.CCOC([SiH3])OCC.
What is the InChIKey of diethoxymethylsilane;propane?
The InChIKey is NNUWZPROQWXQIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O2Si.C3H8/c1-3-6-5(8)7-4-2;1-3-2/h5H,3-4H2,1-2,8H3;3H2,1-2H3.
What are the key properties of diethoxymethylsilane;propane?
diethoxymethylsilane;propane has a molecular weight of 178.35 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxymethylsilane;propane is sourced from PubChem (CID 174925754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).