C21H42O2 — CID 151955749
(1,1-diethoxy-2-methyldecyl)cyclohexane (PubChem CID 151955749) has the molecular formula C21H42O2 and a molecular weight of 326.57 g/mol. Its IUPAC name is (1,1-diethoxy-2-methyldecyl)cyclohexane.
| Compound Name | (1,1-diethoxy-2-methyldecyl)cyclohexane |
|---|---|
| PubChem CID | 151955749 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | (1,1-diethoxy-2-methyldecyl)cyclohexane |
| SMILES | CCCCCCCCC(C)C(OCC)(OCC)C1CCCCC1 |
| InChI | InChI=1S/C21H42O2/c1-5-8-9-10-11-13-16-19(4)21(22-6-2,23-7-3)20-17-14-12-15-18-20/h19-20H,5-18H2,1-4H3 |
| InChIKey | TXPBSEDXZJECRF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|