C20H44 — CID 143333378
2,3-dimethyloctan-2-ylcyclohexane;ethane (PubChem CID 143333378) has the molecular formula C20H44 and a molecular weight of 284.57 g/mol. Its IUPAC name is 2,3-dimethyloctan-2-ylcyclohexane;ethane.
| Compound Name | 2,3-dimethyloctan-2-ylcyclohexane;ethane |
|---|---|
| PubChem CID | 143333378 |
| Molecular Formula | C20H44 |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 284.34 |
| IUPAC Name | 2,3-dimethyloctan-2-ylcyclohexane;ethane |
| SMILES | CC.CC.CCCCCC(C)C(C)(C)C1CCCCC1 |
| InChI | InChI=1S/C16H32.2C2H6/c1-5-6-8-11-14(2)16(3,4)15-12-9-7-10-13-15;2*1-2/h14-15H,5-13H2,1-4H3;2*1-2H3 |
| InChIKey | FOONXRZZJAQXBN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|