C30H58O12 — CID 90229770
bis(1,1,2-triethoxy-2-propoxyethyl) octanedioate (PubChem CID 90229770) has the molecular formula C30H58O12 and a molecular weight of 610.78 g/mol. Its IUPAC name is bis(1,1,2-triethoxy-2-propoxyethyl) octanedioate.
| Compound Name | bis(1,1,2-triethoxy-2-propoxyethyl) octanedioate |
|---|---|
| PubChem CID | 90229770 |
| Molecular Formula | C30H58O12 |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.39 |
| IUPAC Name | bis(1,1,2-triethoxy-2-propoxyethyl) octanedioate |
| SMILES | CCCOC(OCC)C(OCC)(OCC)OC(=O)CCCCCCC(=O)OC(OCC)(OCC)C(OCC)OCCC |
| InChI | InChI=1S/C30H58O12/c1-9-23-35-27(33-11-3)29(37-13-5,38-14-6)41-25(31)21-19-17-18-20-22-26(32)42-30(39-15-7,40-16-8)28(34-12-4)36-24-10-2/h27-28H,9-24H2,1-8H3 |
| InChIKey | ZKOMJIBACABTQN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|