C33H64O13 — CID 90312367
2-(2-butoxy-1,1,2,2-tetraethoxyethyl)-2-(1,1,2-triethoxy-2-propoxyethyl)octanedioic acid (PubChem CID 90312367) has the molecular formula C33H64O13 and a molecular weight of 668.86 g/mol. Its IUPAC name is 2-(2-butoxy-1,1,2,2-tetraethoxyethyl)-2-(1,1,2-triethoxy-2-propoxyethyl)octanedioic acid.
| Compound Name | 2-(2-butoxy-1,1,2,2-tetraethoxyethyl)-2-(1,1,2-triethoxy-2-propoxyethyl)octanedioic acid |
|---|---|
| PubChem CID | 90312367 |
| Molecular Formula | C33H64O13 |
| Molecular Weight | 668.86 g/mol |
| Exact Mass | 668.43 |
| IUPAC Name | 2-(2-butoxy-1,1,2,2-tetraethoxyethyl)-2-(1,1,2-triethoxy-2-propoxyethyl)octanedioic acid |
| SMILES | CCCCOC(OCC)(OCC)C(OCC)(OCC)C(CCCCCC(=O)O)(C(=O)O)C(OCC)(OCC)C(OCC)OCCC |
| InChI | InChI=1S/C33H64O13/c1-10-19-26-46-33(44-17-8,45-18-9)32(42-15-6,43-16-7)30(28(36)37,24-22-20-21-23-27(34)35)31(40-13-4,41-14-5)29(38-12-3)39-25-11-2/h29H,10-26H2,1-9H3,(H,34,35)(H,36,37) |
| InChIKey | ALTGUZUVBQLKNE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.86 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|