C29H56O13 — CID 90312411
2-(1,2,2,2-tetraethoxy-1-methoxyethyl)-2-(1,2,2-triethoxy-1-methoxyethyl)nonanedioic acid (PubChem CID 90312411) has the molecular formula C29H56O13 and a molecular weight of 612.75 g/mol. Its IUPAC name is 2-(1,2,2,2-tetraethoxy-1-methoxyethyl)-2-(1,2,2-triethoxy-1-methoxyethyl)nonanedioic acid.
| Compound Name | 2-(1,2,2,2-tetraethoxy-1-methoxyethyl)-2-(1,2,2-triethoxy-1-methoxyethyl)nonanedioic acid |
|---|---|
| PubChem CID | 90312411 |
| Molecular Formula | C29H56O13 |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 2-(1,2,2,2-tetraethoxy-1-methoxyethyl)-2-(1,2,2-triethoxy-1-methoxyethyl)nonanedioic acid |
| SMILES | CCOC(OCC)C(OC)(OCC)C(CCCCCCC(=O)O)(C(=O)O)C(OC)(OCC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C29H56O13/c1-10-36-25(37-11-2)27(34-8,38-12-3)26(24(32)33,22-20-18-17-19-21-23(30)31)28(35-9,39-13-4)29(40-14-5,41-15-6)42-16-7/h25H,10-22H2,1-9H3,(H,30,31)(H,32,33) |
| InChIKey | YNMIPVQJXURFLM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|