C34H66O13 — CID 154350109
2-(1,2,2,2-tetraethoxy-1-pentoxyethyl)-2-(2,2,2-triethoxy-1-pentoxyethyl)hexanedioic acid (PubChem CID 154350109) has the molecular formula C34H66O13 and a molecular weight of 682.89 g/mol. Its IUPAC name is 2-(1,2,2,2-tetraethoxy-1-pentoxyethyl)-2-(2,2,2-triethoxy-1-pentoxyethyl)hexanedioic acid.
| Compound Name | 2-(1,2,2,2-tetraethoxy-1-pentoxyethyl)-2-(2,2,2-triethoxy-1-pentoxyethyl)hexanedioic acid |
|---|---|
| PubChem CID | 154350109 |
| Molecular Formula | C34H66O13 |
| Molecular Weight | 682.89 g/mol |
| Exact Mass | 682.45 |
| IUPAC Name | 2-(1,2,2,2-tetraethoxy-1-pentoxyethyl)-2-(2,2,2-triethoxy-1-pentoxyethyl)hexanedioic acid |
| SMILES | CCCCCOC(C(OCC)(OCC)OCC)C(CCCC(=O)O)(C(=O)O)C(OCC)(OCCCCC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C34H66O13/c1-10-19-21-26-39-29(32(40-12-3,41-13-4)42-14-5)31(30(37)38,25-23-24-28(35)36)33(43-15-6,47-27-22-20-11-2)34(44-16-7,45-17-8)46-18-9/h29H,10-27H2,1-9H3,(H,35,36)(H,37,38) |
| InChIKey | ZLKCUGMATVULAE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.89 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|