C37H72O13 — CID 90229953
9-oxo-9-[1,2,2-triethoxy-2-pentoxy-1-(3,3,4-triethoxy-4-pentoxybutan-2-yl)oxyethoxy]nonanoic acid (PubChem CID 90229953) has the molecular formula C37H72O13 and a molecular weight of 724.97 g/mol. Its IUPAC name is 9-oxo-9-[1,2,2-triethoxy-2-pentoxy-1-(3,3,4-triethoxy-4-pentoxybutan-2-yl)oxyethoxy]nonanoic acid.
| Compound Name | 9-oxo-9-[1,2,2-triethoxy-2-pentoxy-1-(3,3,4-triethoxy-4-pentoxybutan-2-yl)oxyethoxy]nonanoic acid |
|---|---|
| PubChem CID | 90229953 |
| Molecular Formula | C37H72O13 |
| Molecular Weight | 724.97 g/mol |
| Exact Mass | 724.50 |
| IUPAC Name | 9-oxo-9-[1,2,2-triethoxy-2-pentoxy-1-(3,3,4-triethoxy-4-pentoxybutan-2-yl)oxyethoxy]nonanoic acid |
| SMILES | CCCCCOC(OCC)C(OCC)(OCC)C(C)OC(OCC)(OC(=O)CCCCCCCC(=O)O)C(OCC)(OCC)OCCCCC |
| InChI | InChI=1S/C37H72O13/c1-10-18-25-29-42-34(41-12-3)35(43-13-4,44-14-5)31(9)49-37(47-17-8,36(45-15-6,46-16-7)48-30-26-19-11-2)50-33(40)28-24-22-20-21-23-27-32(38)39/h31,34H,10-30H2,1-9H3,(H,38,39) |
| InChIKey | JYFOMVZSJVGBKR-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 146.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.97 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|