C20H37O8- — CID 131717353
6-(1,1-dibutoxy-2,2-diethoxyethoxy)-6-oxohexanoate (PubChem CID 131717353) has the molecular formula C20H37O8- and a molecular weight of 405.51 g/mol. Its IUPAC name is 6-(1,1-dibutoxy-2,2-diethoxyethoxy)-6-oxohexanoate.
| Compound Name | 6-(1,1-dibutoxy-2,2-diethoxyethoxy)-6-oxohexanoate |
|---|---|
| PubChem CID | 131717353 |
| Molecular Formula | C20H37O8- |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 6-(1,1-dibutoxy-2,2-diethoxyethoxy)-6-oxohexanoate |
| SMILES | CCCCOC(OCCCC)(OC(=O)CCCCC(=O)[O-])C(OCC)OCC |
| InChI | InChI=1S/C20H38O8/c1-5-9-15-26-20(27-16-10-6-2,19(24-7-3)25-8-4)28-18(23)14-12-11-13-17(21)22/h19H,5-16H2,1-4H3,(H,21,22)/p-1 |
| InChIKey | QRURWNYHSUWCSA-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|