C10H21Cl3O — CID 89439403
ethoxyethane;1,2,3-trichlorohexane (PubChem CID 89439403) has the molecular formula C10H21Cl3O and a molecular weight of 263.64 g/mol. Its IUPAC name is ethoxyethane;1,2,3-trichlorohexane.
| Compound Name | ethoxyethane;1,2,3-trichlorohexane |
|---|---|
| PubChem CID | 89439403 |
| Molecular Formula | C10H21Cl3O |
| Molecular Weight | 263.64 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | ethoxyethane;1,2,3-trichlorohexane |
| SMILES | CCCC(Cl)C(Cl)CCl.CCOCC |
| InChI | InChI=1S/C6H11Cl3.C4H10O/c1-2-3-5(8)6(9)4-7;1-3-5-4-2/h5-6H,2-4H2,1H3;3-4H2,1-2H3 |
| InChIKey | LLXGTQKCABKPRN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|