About 1,2-dichloroethoxyalumane
1,2-dichloroethoxyalumane (PubChem CID 173200961) has the molecular formula C2H5AlCl2O
and a molecular weight of 142.95 g/mol. Its IUPAC name is 1,2-dichloroethoxyalumane.
Molecular Properties
| Compound Name | 1,2-dichloroethoxyalumane |
| PubChem CID | 173200961 |
| Molecular Formula | C2H5AlCl2O |
| Molecular Weight | 142.95 g/mol |
| Exact Mass | 141.95 |
| IUPAC Name | 1,2-dichloroethoxyalumane |
| SMILES | [AlH2]OC(Cl)CCl |
| InChI | InChI=1S/C2H3Cl2O.Al.2H/c3-1-2(4)5;;;/h2H,1H2;;;/q-1;+1;; |
| InChIKey | KTXWNCXRWMWQMS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.95 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloroethoxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloroethoxyalumane?
The IUPAC name of 1,2-dichloroethoxyalumane (CID 173200961) is 1,2-dichloroethoxyalumane.
What is the SMILES notation for 1,2-dichloroethoxyalumane?
The canonical SMILES for 1,2-dichloroethoxyalumane is [AlH2]OC(Cl)CCl.
What is the InChIKey of 1,2-dichloroethoxyalumane?
The InChIKey is KTXWNCXRWMWQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3Cl2O.Al.2H/c3-1-2(4)5;;;/h2H,1H2;;;/q-1;+1;;.
What are the key properties of 1,2-dichloroethoxyalumane?
1,2-dichloroethoxyalumane has a molecular weight of 142.95 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroethoxyalumane is sourced from PubChem (CID 173200961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).