About 1,2-dichloroethyl dihydrogen phosphite
1,2-dichloroethyl dihydrogen phosphite (PubChem CID 57144706) has the molecular formula C2H5Cl2O3P
and a molecular weight of 178.94 g/mol. Its IUPAC name is 1,2-dichloroethyl dihydrogen phosphite.
Molecular Properties
| Compound Name | 1,2-dichloroethyl dihydrogen phosphite |
| PubChem CID | 57144706 |
| Molecular Formula | C2H5Cl2O3P |
| Molecular Weight | 178.94 g/mol |
| Exact Mass | 177.94 |
| IUPAC Name | 1,2-dichloroethyl dihydrogen phosphite |
| SMILES | OP(O)OC(Cl)CCl |
| InChI | InChI=1S/C2H5Cl2O3P/c3-1-2(4)7-8(5)6/h2,5-6H,1H2 |
| InChIKey | OSIKRCMGPRNKDT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.94 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloroethyl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloroethyl dihydrogen phosphite?
The IUPAC name of 1,2-dichloroethyl dihydrogen phosphite (CID 57144706) is 1,2-dichloroethyl dihydrogen phosphite.
What is the SMILES notation for 1,2-dichloroethyl dihydrogen phosphite?
The canonical SMILES for 1,2-dichloroethyl dihydrogen phosphite is OP(O)OC(Cl)CCl.
What is the InChIKey of 1,2-dichloroethyl dihydrogen phosphite?
The InChIKey is OSIKRCMGPRNKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5Cl2O3P/c3-1-2(4)7-8(5)6/h2,5-6H,1H2.
What are the key properties of 1,2-dichloroethyl dihydrogen phosphite?
1,2-dichloroethyl dihydrogen phosphite has a molecular weight of 178.94 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroethyl dihydrogen phosphite is sourced from PubChem (CID 57144706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).