About dichloromethane;dichloromethylsilane
dichloromethane;dichloromethylsilane (PubChem CID 173165759) has the molecular formula C2H6Cl4Si
and a molecular weight of 199.97 g/mol. Its IUPAC name is dichloromethane;dichloromethylsilane.
Molecular Properties
| Compound Name | dichloromethane;dichloromethylsilane |
| PubChem CID | 173165759 |
| Molecular Formula | C2H6Cl4Si |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 197.90 |
| IUPAC Name | dichloromethane;dichloromethylsilane |
| SMILES | ClCCl.[SiH3]C(Cl)Cl |
| InChI | InChI=1S/CH4Cl2Si.CH2Cl2/c2-1(3)4;2-1-3/h1H,4H3;1H2 |
| InChIKey | WJYIQLGTDNFLEF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;dichloromethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;dichloromethylsilane?
The IUPAC name of dichloromethane;dichloromethylsilane (CID 173165759) is dichloromethane;dichloromethylsilane.
What is the SMILES notation for dichloromethane;dichloromethylsilane?
The canonical SMILES for dichloromethane;dichloromethylsilane is ClCCl.[SiH3]C(Cl)Cl.
What is the InChIKey of dichloromethane;dichloromethylsilane?
The InChIKey is WJYIQLGTDNFLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4Cl2Si.CH2Cl2/c2-1(3)4;2-1-3/h1H,4H3;1H2.
What are the key properties of dichloromethane;dichloromethylsilane?
dichloromethane;dichloromethylsilane has a molecular weight of 199.97 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;dichloromethylsilane is sourced from PubChem (CID 173165759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).