C5H10Cl2 — CID 6431009
(2R,3R)-2,3-dichloropentane (PubChem CID 6431009) has the molecular formula C5H10Cl2 and a molecular weight of 141.04 g/mol. Its IUPAC name is (2R,3R)-2,3-dichloropentane.
| Compound Name | (2R,3R)-2,3-dichloropentane |
|---|---|
| PubChem CID | 6431009 |
| Molecular Formula | C5H10Cl2 |
| Molecular Weight | 141.04 g/mol |
| Exact Mass | 140.02 |
| IUPAC Name | (2R,3R)-2,3-dichloropentane |
| SMILES | CC[C@@H](Cl)[C@@H](C)Cl |
| InChI | InChI=1S/C5H10Cl2/c1-3-5(7)4(2)6/h4-5H,3H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | HVFJQRZGBBKTPL-RFZPGFLSSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.04 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|