C10H18Cl4S — CID 22211748
1,3-dichloro-2-[[3-chloro-2-(chloromethyl)butyl]sulfanylmethyl]butane (PubChem CID 22211748) has the molecular formula C10H18Cl4S and a molecular weight of 312.13 g/mol. Its IUPAC name is 1,3-dichloro-2-[[3-chloro-2-(chloromethyl)butyl]sulfanylmethyl]butane.
| Compound Name | 1,3-dichloro-2-[[3-chloro-2-(chloromethyl)butyl]sulfanylmethyl]butane |
|---|---|
| PubChem CID | 22211748 |
| Molecular Formula | C10H18Cl4S |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 1,3-dichloro-2-[[3-chloro-2-(chloromethyl)butyl]sulfanylmethyl]butane |
| SMILES | CC(Cl)C(CCl)CSCC(CCl)C(C)Cl |
| InChI | InChI=1S/C10H18Cl4S/c1-7(13)9(3-11)5-15-6-10(4-12)8(2)14/h7-10H,3-6H2,1-2H3 |
| InChIKey | RPMILSZNKBHSRI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|