About 1-bromo-2-chloropropane;2-chloropropane
1-bromo-2-chloropropane;2-chloropropane (PubChem CID 174371360) has the molecular formula C6H13BrCl2
and a molecular weight of 235.98 g/mol. Its IUPAC name is 1-bromo-2-chloropropane;2-chloropropane.
Molecular Properties
| Compound Name | 1-bromo-2-chloropropane;2-chloropropane |
| PubChem CID | 174371360 |
| Molecular Formula | C6H13BrCl2 |
| Molecular Weight | 235.98 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | 1-bromo-2-chloropropane;2-chloropropane |
| SMILES | CC(C)Cl.CC(Cl)CBr |
| InChI | InChI=1S/C3H6BrCl.C3H7Cl/c1-3(5)2-4;1-3(2)4/h3H,2H2,1H3;3H,1-2H3 |
| InChIKey | MJAOARUQFXNCKR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-chloropropane;2-chloropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-chloropropane;2-chloropropane?
The IUPAC name of 1-bromo-2-chloropropane;2-chloropropane (CID 174371360) is 1-bromo-2-chloropropane;2-chloropropane.
What is the SMILES notation for 1-bromo-2-chloropropane;2-chloropropane?
The canonical SMILES for 1-bromo-2-chloropropane;2-chloropropane is CC(C)Cl.CC(Cl)CBr.
What is the InChIKey of 1-bromo-2-chloropropane;2-chloropropane?
The InChIKey is MJAOARUQFXNCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrCl.C3H7Cl/c1-3(5)2-4;1-3(2)4/h3H,2H2,1H3;3H,1-2H3.
What are the key properties of 1-bromo-2-chloropropane;2-chloropropane?
1-bromo-2-chloropropane;2-chloropropane has a molecular weight of 235.98 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-chloropropane;2-chloropropane is sourced from PubChem (CID 174371360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).