C12H24OS — CID 162170254
2,6-dimethyl-4-(1-sulfanylpropan-2-yl)heptan-3-one (PubChem CID 162170254) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1-sulfanylpropan-2-yl)heptan-3-one.
| Compound Name | 2,6-dimethyl-4-(1-sulfanylpropan-2-yl)heptan-3-one |
|---|---|
| PubChem CID | 162170254 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,6-dimethyl-4-(1-sulfanylpropan-2-yl)heptan-3-one |
| SMILES | CC(C)CC(C(=O)C(C)C)C(C)CS |
| InChI | InChI=1S/C12H24OS/c1-8(2)6-11(10(5)7-14)12(13)9(3)4/h8-11,14H,6-7H2,1-5H3 |
| InChIKey | QSUXNYJSDFHVRY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|