C13H26O — CID 162101589
(4R)-2,5-dimethyl-4-(2-methylpropyl)heptan-3-one (PubChem CID 162101589) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (4R)-2,5-dimethyl-4-(2-methylpropyl)heptan-3-one.
| Compound Name | (4R)-2,5-dimethyl-4-(2-methylpropyl)heptan-3-one |
|---|---|
| PubChem CID | 162101589 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (4R)-2,5-dimethyl-4-(2-methylpropyl)heptan-3-one |
| SMILES | CCC(C)[C@@H](CC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C13H26O/c1-7-11(6)12(8-9(2)3)13(14)10(4)5/h9-12H,7-8H2,1-6H3/t11?,12-/m1/s1 |
| InChIKey | FICABEYSLRITMB-PIJUOVFKSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |