About 2,4-dimethylpentane;ethane;heptane
2,4-dimethylpentane;ethane;heptane (PubChem CID 153392396) has the molecular formula C16H38
and a molecular weight of 230.48 g/mol. Its IUPAC name is 2,4-dimethylpentane;ethane;heptane.
Molecular Properties
| Compound Name | 2,4-dimethylpentane;ethane;heptane |
| PubChem CID | 153392396 |
| Molecular Formula | C16H38 |
| Molecular Weight | 230.48 g/mol |
| Exact Mass | 230.30 |
| IUPAC Name | 2,4-dimethylpentane;ethane;heptane |
| SMILES | CC.CC(C)CC(C)C.CCCCCCC |
| InChI | InChI=1S/2C7H16.C2H6/c1-6(2)5-7(3)4;1-3-5-7-6-4-2;1-2/h6-7H,5H2,1-4H3;3-7H2,1-2H3;1-2H3 |
| InChIKey | KQJZPNANHMSUCR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpentane;ethane;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentane;ethane;heptane?
The IUPAC name of 2,4-dimethylpentane;ethane;heptane (CID 153392396) is 2,4-dimethylpentane;ethane;heptane.
What is the SMILES notation for 2,4-dimethylpentane;ethane;heptane?
The canonical SMILES for 2,4-dimethylpentane;ethane;heptane is CC.CC(C)CC(C)C.CCCCCCC.
What is the InChIKey of 2,4-dimethylpentane;ethane;heptane?
The InChIKey is KQJZPNANHMSUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16.C2H6/c1-6(2)5-7(3)4;1-3-5-7-6-4-2;1-2/h6-7H,5H2,1-4H3;3-7H2,1-2H3;1-2H3.
What are the key properties of 2,4-dimethylpentane;ethane;heptane?
2,4-dimethylpentane;ethane;heptane has a molecular weight of 230.48 g/mol, XLogP of 6.69, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentane;ethane;heptane is sourced from PubChem (CID 153392396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).