C9H19- — CID 90756934
2,5-dimethylheptane (PubChem CID 90756934) has the molecular formula C9H19- and a molecular weight of 127.25 g/mol. Its IUPAC name is 2,5-dimethylheptane.
| Compound Name | 2,5-dimethylheptane |
|---|---|
| PubChem CID | 90756934 |
| Molecular Formula | C9H19- |
| Molecular Weight | 127.25 g/mol |
| Exact Mass | 127.15 |
| IUPAC Name | 2,5-dimethylheptane |
| SMILES | [CH2-]CC(C)CCC(C)C |
| InChI | InChI=1S/C9H19/c1-5-9(4)7-6-8(2)3/h8-9H,1,5-7H2,2-4H3/q-1 |
| InChIKey | JGBJSIZWUDTLDR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|