About zinc bis(2-methylpentane)
zinc bis(2-methylpentane) (PubChem CID 11481754) has the molecular formula C12H26Zn
and a molecular weight of 235.73 g/mol. Its IUPAC name is zinc bis(2-methylpentane).
Molecular Properties
| Compound Name | zinc bis(2-methylpentane) |
| PubChem CID | 11481754 |
| Molecular Formula | C12H26Zn |
| Molecular Weight | 235.73 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | zinc bis(2-methylpentane) |
| SMILES | [CH2-]CCC(C)C.[CH2-]CCC(C)C.[Zn+2] |
| InChI | InChI=1S/2C6H13.Zn/c2*1-4-5-6(2)3;/h2*6H,1,4-5H2,2-3H3;/q2*-1;+2 |
| InChIKey | GGLPFGPIOMLKRO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(2-methylpentane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(2-methylpentane)?
The IUPAC name of zinc bis(2-methylpentane) (CID 11481754) is zinc bis(2-methylpentane).
What is the SMILES notation for zinc bis(2-methylpentane)?
The canonical SMILES for zinc bis(2-methylpentane) is [CH2-]CCC(C)C.[CH2-]CCC(C)C.[Zn+2].
What is the InChIKey of zinc bis(2-methylpentane)?
The InChIKey is GGLPFGPIOMLKRO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13.Zn/c2*1-4-5-6(2)3;/h2*6H,1,4-5H2,2-3H3;/q2*-1;+2.
What are the key properties of zinc bis(2-methylpentane)?
zinc bis(2-methylpentane) has a molecular weight of 235.73 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(2-methylpentane) is sourced from PubChem (CID 11481754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).