About ethane;lanthanum;2-methylpentane
ethane;lanthanum;2-methylpentane (PubChem CID 154248830) has the molecular formula C8H18La-2
and a molecular weight of 253.14 g/mol. Its IUPAC name is ethane;lanthanum;2-methylpentane.
Molecular Properties
| Compound Name | ethane;lanthanum;2-methylpentane |
| PubChem CID | 154248830 |
| Molecular Formula | C8H18La-2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | ethane;lanthanum;2-methylpentane |
| SMILES | [CH2-]C.[CH2-]CCC(C)C.[La] |
| InChI | InChI=1S/C6H13.C2H5.La/c1-4-5-6(2)3;1-2;/h6H,1,4-5H2,2-3H3;1H2,2H3;/q2*-1; |
| InChIKey | CJJPIFYRQGIRIZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;lanthanum;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;lanthanum;2-methylpentane?
The IUPAC name of ethane;lanthanum;2-methylpentane (CID 154248830) is ethane;lanthanum;2-methylpentane.
What is the SMILES notation for ethane;lanthanum;2-methylpentane?
The canonical SMILES for ethane;lanthanum;2-methylpentane is [CH2-]C.[CH2-]CCC(C)C.[La].
What is the InChIKey of ethane;lanthanum;2-methylpentane?
The InChIKey is CJJPIFYRQGIRIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13.C2H5.La/c1-4-5-6(2)3;1-2;/h6H,1,4-5H2,2-3H3;1H2,2H3;/q2*-1;.
What are the key properties of ethane;lanthanum;2-methylpentane?
ethane;lanthanum;2-methylpentane has a molecular weight of 253.14 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;lanthanum;2-methylpentane is sourced from PubChem (CID 154248830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).