About 2-methylpentane;rubidium(1+)
2-methylpentane;rubidium(1+) (PubChem CID 163579122) has the molecular formula C6H13Rb
and a molecular weight of 170.64 g/mol. Its IUPAC name is 2-methylpentane;rubidium(1+).
Molecular Properties
| Compound Name | 2-methylpentane;rubidium(1+) |
| PubChem CID | 163579122 |
| Molecular Formula | C6H13Rb |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 2-methylpentane;rubidium(1+) |
| SMILES | [CH2-]CCC(C)C.[Rb+] |
| InChI | InChI=1S/C6H13.Rb/c1-4-5-6(2)3;/h6H,1,4-5H2,2-3H3;/q-1;+1 |
| InChIKey | JOGJSCXGHTVNHV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane;rubidium(1+)?
The IUPAC name of 2-methylpentane;rubidium(1+) (CID 163579122) is 2-methylpentane;rubidium(1+).
What is the SMILES notation for 2-methylpentane;rubidium(1+)?
The canonical SMILES for 2-methylpentane;rubidium(1+) is [CH2-]CCC(C)C.[Rb+].
What is the InChIKey of 2-methylpentane;rubidium(1+)?
The InChIKey is JOGJSCXGHTVNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13.Rb/c1-4-5-6(2)3;/h6H,1,4-5H2,2-3H3;/q-1;+1.
What are the key properties of 2-methylpentane;rubidium(1+)?
2-methylpentane;rubidium(1+) has a molecular weight of 170.64 g/mol, XLogP of -0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane;rubidium(1+) is sourced from PubChem (CID 163579122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).