About bis(2-methylbutane);yttrium
bis(2-methylbutane);yttrium (PubChem CID 140616958) has the molecular formula C10H22Y-2
and a molecular weight of 231.19 g/mol. Its IUPAC name is bis(2-methylbutane);yttrium.
Molecular Properties
| Compound Name | bis(2-methylbutane);yttrium |
| PubChem CID | 140616958 |
| Molecular Formula | C10H22Y-2 |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | bis(2-methylbutane);yttrium |
| SMILES | [CH2-]CC(C)C.[CH2-]CC(C)C.[Y] |
| InChI | InChI=1S/2C5H11.Y/c2*1-4-5(2)3;/h2*5H,1,4H2,2-3H3;/q2*-1; |
| InChIKey | KVCHLBCDOLQNDN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylbutane);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutane);yttrium?
The IUPAC name of bis(2-methylbutane);yttrium (CID 140616958) is bis(2-methylbutane);yttrium.
What is the SMILES notation for bis(2-methylbutane);yttrium?
The canonical SMILES for bis(2-methylbutane);yttrium is [CH2-]CC(C)C.[CH2-]CC(C)C.[Y].
What is the InChIKey of bis(2-methylbutane);yttrium?
The InChIKey is KVCHLBCDOLQNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11.Y/c2*1-4-5(2)3;/h2*5H,1,4H2,2-3H3;/q2*-1;.
What are the key properties of bis(2-methylbutane);yttrium?
bis(2-methylbutane);yttrium has a molecular weight of 231.19 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutane);yttrium is sourced from PubChem (CID 140616958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).