About 4-ethyl-2-methylhexane;yttrium
4-ethyl-2-methylhexane;yttrium (PubChem CID 58009185) has the molecular formula C9H18Y-2
and a molecular weight of 215.15 g/mol. Its IUPAC name is 4-ethyl-2-methylhexane;yttrium.
Molecular Properties
| Compound Name | 4-ethyl-2-methylhexane;yttrium |
| PubChem CID | 58009185 |
| Molecular Formula | C9H18Y-2 |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-ethyl-2-methylhexane;yttrium |
| SMILES | [CH2-]CC(C[CH2-])CC(C)C.[Y] |
| InChI | InChI=1S/C9H18.Y/c1-5-9(6-2)7-8(3)4;/h8-9H,1-2,5-7H2,3-4H3;/q-2; |
| InChIKey | ZQMZIGQKGGNTOV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-methylhexane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylhexane;yttrium?
The IUPAC name of 4-ethyl-2-methylhexane;yttrium (CID 58009185) is 4-ethyl-2-methylhexane;yttrium.
What is the SMILES notation for 4-ethyl-2-methylhexane;yttrium?
The canonical SMILES for 4-ethyl-2-methylhexane;yttrium is [CH2-]CC(C[CH2-])CC(C)C.[Y].
What is the InChIKey of 4-ethyl-2-methylhexane;yttrium?
The InChIKey is ZQMZIGQKGGNTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.Y/c1-5-9(6-2)7-8(3)4;/h8-9H,1-2,5-7H2,3-4H3;/q-2;.
What are the key properties of 4-ethyl-2-methylhexane;yttrium?
4-ethyl-2-methylhexane;yttrium has a molecular weight of 215.15 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylhexane;yttrium is sourced from PubChem (CID 58009185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).