About actinium;2-ethylpropane-1,3-diol;yttrium
actinium;2-ethylpropane-1,3-diol;yttrium (PubChem CID 59047614) has the molecular formula C5H11Ac2O2Y-
and a molecular weight of 646.05 g/mol. Its IUPAC name is actinium;2-ethylpropane-1,3-diol;yttrium.
Molecular Properties
| Compound Name | actinium;2-ethylpropane-1,3-diol;yttrium |
| PubChem CID | 59047614 |
| Molecular Formula | C5H11Ac2O2Y- |
| Molecular Weight | 646.05 g/mol |
| Exact Mass | 646.04 |
| IUPAC Name | actinium;2-ethylpropane-1,3-diol;yttrium |
| SMILES | [Ac].[Ac].[CH2-]CC(CO)CO.[Y] |
| InChI | InChI=1S/C5H11O2.2Ac.Y/c1-2-5(3-6)4-7;;;/h5-7H,1-4H2;;;/q-1;;; |
| InChIKey | WMCZHMXDZTWYKA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 646.05 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze actinium;2-ethylpropane-1,3-diol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;2-ethylpropane-1,3-diol;yttrium?
The IUPAC name of actinium;2-ethylpropane-1,3-diol;yttrium (CID 59047614) is actinium;2-ethylpropane-1,3-diol;yttrium.
What is the SMILES notation for actinium;2-ethylpropane-1,3-diol;yttrium?
The canonical SMILES for actinium;2-ethylpropane-1,3-diol;yttrium is [Ac].[Ac].[CH2-]CC(CO)CO.[Y].
What is the InChIKey of actinium;2-ethylpropane-1,3-diol;yttrium?
The InChIKey is WMCZHMXDZTWYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O2.2Ac.Y/c1-2-5(3-6)4-7;;;/h5-7H,1-4H2;;;/q-1;;;.
What are the key properties of actinium;2-ethylpropane-1,3-diol;yttrium?
actinium;2-ethylpropane-1,3-diol;yttrium has a molecular weight of 646.05 g/mol, XLogP of -0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2-ethylpropane-1,3-diol;yttrium is sourced from PubChem (CID 59047614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).