About 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium)
3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) (PubChem CID 58697885) has the molecular formula C16H31Y3-3
and a molecular weight of 490.14 g/mol. Its IUPAC name is 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium).
Molecular Properties
| Compound Name | 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) |
| PubChem CID | 58697885 |
| Molecular Formula | C16H31Y3-3 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 489.96 |
| IUPAC Name | 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) |
| SMILES | [CH2-]CC(C)CC(CC(C)C[CH2-])CC(C)C[CH2-].[Y].[Y].[Y] |
| InChI | InChI=1S/C16H31.3Y/c1-7-13(4)10-16(11-14(5)8-2)12-15(6)9-3;;;/h13-16H,1-3,7-12H2,4-6H3;;;/q-3;;; |
| InChIKey | HTUHPMGRBVYBQY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium)?
The IUPAC name of 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) (CID 58697885) is 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium).
What is the SMILES notation for 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium)?
The canonical SMILES for 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) is [CH2-]CC(C)CC(CC(C)C[CH2-])CC(C)C[CH2-].[Y].[Y].[Y].
What is the InChIKey of 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium)?
The InChIKey is HTUHPMGRBVYBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31.3Y/c1-7-13(4)10-16(11-14(5)8-2)12-15(6)9-3;;;/h13-16H,1-3,7-12H2,4-6H3;;;/q-3;;;.
What are the key properties of 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium)?
3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) has a molecular weight of 490.14 g/mol, XLogP of 5.35, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-5-(2-methylbutyl)nonane;tris(yttrium) is sourced from PubChem (CID 58697885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).