About 3-methylpentane;zinc
3-methylpentane;zinc (PubChem CID 154150944) has the molecular formula C6H13Zn-
and a molecular weight of 150.56 g/mol. Its IUPAC name is 3-methylpentane;zinc.
Molecular Properties
| Compound Name | 3-methylpentane;zinc |
| PubChem CID | 154150944 |
| Molecular Formula | C6H13Zn- |
| Molecular Weight | 150.56 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 3-methylpentane;zinc |
| SMILES | [CH2-]CC(C)CC.[Zn] |
| InChI | InChI=1S/C6H13.Zn/c1-4-6(3)5-2;/h6H,1,4-5H2,2-3H3;/q-1; |
| InChIKey | LGNVYAJUAHCYMV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentane;zinc?
The IUPAC name of 3-methylpentane;zinc (CID 154150944) is 3-methylpentane;zinc.
What is the SMILES notation for 3-methylpentane;zinc?
The canonical SMILES for 3-methylpentane;zinc is [CH2-]CC(C)CC.[Zn].
What is the InChIKey of 3-methylpentane;zinc?
The InChIKey is LGNVYAJUAHCYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13.Zn/c1-4-6(3)5-2;/h6H,1,4-5H2,2-3H3;/q-1;.
What are the key properties of 3-methylpentane;zinc?
3-methylpentane;zinc has a molecular weight of 150.56 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentane;zinc is sourced from PubChem (CID 154150944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).