About curium;3-methylheptane
curium;3-methylheptane (PubChem CID 59030306) has the molecular formula C8H17Cm-
and a molecular weight of 360.22 g/mol. Its IUPAC name is curium;3-methylheptane.
Molecular Properties
| Compound Name | curium;3-methylheptane |
| PubChem CID | 59030306 |
| Molecular Formula | C8H17Cm- |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | curium;3-methylheptane |
| SMILES | [CH2-]CC(C)CCCC.[Cm] |
| InChI | InChI=1S/C8H17.Cm/c1-4-6-7-8(3)5-2;/h8H,2,4-7H2,1,3H3;/q-1; |
| InChIKey | UJIWQCCXOPVEJO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze curium;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of curium;3-methylheptane?
The IUPAC name of curium;3-methylheptane (CID 59030306) is curium;3-methylheptane.
What is the SMILES notation for curium;3-methylheptane?
The canonical SMILES for curium;3-methylheptane is [CH2-]CC(C)CCCC.[Cm].
What is the InChIKey of curium;3-methylheptane?
The InChIKey is UJIWQCCXOPVEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.Cm/c1-4-6-7-8(3)5-2;/h8H,2,4-7H2,1,3H3;/q-1;.
What are the key properties of curium;3-methylheptane?
curium;3-methylheptane has a molecular weight of 360.22 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for curium;3-methylheptane is sourced from PubChem (CID 59030306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).