C9H19Li — CID 19358976
lithium 2,2,4-trimethylhexane (PubChem CID 19358976) has the molecular formula C9H19Li and a molecular weight of 134.19 g/mol. Its IUPAC name is lithium 2,2,4-trimethylhexane.
| Compound Name | lithium 2,2,4-trimethylhexane |
|---|---|
| PubChem CID | 19358976 |
| Molecular Formula | C9H19Li |
| Molecular Weight | 134.19 g/mol |
| Exact Mass | 134.16 |
| IUPAC Name | lithium 2,2,4-trimethylhexane |
| SMILES | [CH2-]CC(C)CC(C)(C)C.[Li+] |
| InChI | InChI=1S/C9H19.Li/c1-6-8(2)7-9(3,4)5;/h8H,1,6-7H2,2-5H3;/q-1;+1 |
| InChIKey | RFIURFQQRNHSDO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|