About Aluminum, hydrobis(2,4,4-trimethylpentyl)-
Aluminum, hydrobis(2,4,4-trimethylpentyl)- (PubChem CID 16684520) has the molecular formula C16H34Al
and a molecular weight of 253.43 g/mol.
Analyze Aluminum, hydrobis(2,4,4-trimethylpentyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aluminum, hydrobis(2,4,4-trimethylpentyl)-?
The IUPAC name of Aluminum, hydrobis(2,4,4-trimethylpentyl)- (CID 16684520) is not available.
What is the SMILES notation for Aluminum, hydrobis(2,4,4-trimethylpentyl)-?
The canonical SMILES for Aluminum, hydrobis(2,4,4-trimethylpentyl)- is CC(C[Al]CC(C)CC(C)(C)C)CC(C)(C)C.
What is the InChIKey of Aluminum, hydrobis(2,4,4-trimethylpentyl)-?
The InChIKey is DSDJNWYBXQXLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H17.Al/c2*1-7(2)6-8(3,4)5;/h2*7H,1,6H2,2-5H3;.
What are the key properties of Aluminum, hydrobis(2,4,4-trimethylpentyl)-?
Aluminum, hydrobis(2,4,4-trimethylpentyl)- has a molecular weight of 253.43 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Aluminum, hydrobis(2,4,4-trimethylpentyl)- is sourced from PubChem (CID 16684520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).