C21H42N2O2 — CID 88746453
2,8-dimethyl-4,6-bis(2-methylpropyl)nonane;isocyanic acid (PubChem CID 88746453) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2,8-dimethyl-4,6-bis(2-methylpropyl)nonane;isocyanic acid.
| Compound Name | 2,8-dimethyl-4,6-bis(2-methylpropyl)nonane;isocyanic acid |
|---|---|
| PubChem CID | 88746453 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | 2,8-dimethyl-4,6-bis(2-methylpropyl)nonane;isocyanic acid |
| SMILES | CC(C)CC(CC(C)C)CC(CC(C)C)CC(C)C.N=C=O.N=C=O |
| InChI | InChI=1S/C19H40.2CHNO/c1-14(2)9-18(10-15(3)4)13-19(11-16(5)6)12-17(7)8;2*2-1-3/h14-19H,9-13H2,1-8H3;2*2H |
| InChIKey | OHJZIOYWINBJPE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|