About 5-methylhexane-2-thiol
5-methylhexane-2-thiol (PubChem CID 43124113) has the molecular formula C7H16S
and a molecular weight of 132.27 g/mol. Its IUPAC name is 5-methylhexane-2-thiol.
Molecular Properties
| Compound Name | 5-methylhexane-2-thiol |
| PubChem CID | 43124113 |
| Molecular Formula | C7H16S |
| Molecular Weight | 132.27 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 5-methylhexane-2-thiol |
| SMILES | CC(C)CCC(C)S |
| InChI | InChI=1S/C7H16S/c1-6(2)4-5-7(3)8/h6-8H,4-5H2,1-3H3 |
| InChIKey | NLMTWSIPPXEZJG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexane-2-thiol?
The IUPAC name of 5-methylhexane-2-thiol (CID 43124113) is 5-methylhexane-2-thiol.
What is the SMILES notation for 5-methylhexane-2-thiol?
The canonical SMILES for 5-methylhexane-2-thiol is CC(C)CCC(C)S.
What is the InChIKey of 5-methylhexane-2-thiol?
The InChIKey is NLMTWSIPPXEZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16S/c1-6(2)4-5-7(3)8/h6-8H,4-5H2,1-3H3.
What are the key properties of 5-methylhexane-2-thiol?
5-methylhexane-2-thiol has a molecular weight of 132.27 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexane-2-thiol is sourced from PubChem (CID 43124113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).