About tridecane-2,12-dithiol
tridecane-2,12-dithiol (PubChem CID 118018691) has the molecular formula C13H28S2
and a molecular weight of 248.50 g/mol. Its IUPAC name is tridecane-2,12-dithiol.
Molecular Properties
| Compound Name | tridecane-2,12-dithiol |
| PubChem CID | 118018691 |
| Molecular Formula | C13H28S2 |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | tridecane-2,12-dithiol |
| SMILES | CC(S)CCCCCCCCCC(C)S |
| InChI | InChI=1S/C13H28S2/c1-12(14)10-8-6-4-3-5-7-9-11-13(2)15/h12-15H,3-11H2,1-2H3 |
| InChIKey | QXWAEWNYRGFKBJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tridecane-2,12-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecane-2,12-dithiol?
The IUPAC name of tridecane-2,12-dithiol (CID 118018691) is tridecane-2,12-dithiol.
What is the SMILES notation for tridecane-2,12-dithiol?
The canonical SMILES for tridecane-2,12-dithiol is CC(S)CCCCCCCCCC(C)S.
What is the InChIKey of tridecane-2,12-dithiol?
The InChIKey is QXWAEWNYRGFKBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28S2/c1-12(14)10-8-6-4-3-5-7-9-11-13(2)15/h12-15H,3-11H2,1-2H3.
What are the key properties of tridecane-2,12-dithiol?
tridecane-2,12-dithiol has a molecular weight of 248.50 g/mol, XLogP of 5.13, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tridecane-2,12-dithiol is sourced from PubChem (CID 118018691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).