About butane-1,3-dithiol
butane-1,3-dithiol (PubChem CID 520119) has the molecular formula C4H10S2
and a molecular weight of 122.26 g/mol. Its IUPAC name is butane-1,3-dithiol.
Molecular Properties
| Compound Name | butane-1,3-dithiol |
| PubChem CID | 520119 |
| Molecular Formula | C4H10S2 |
| Molecular Weight | 122.26 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | butane-1,3-dithiol |
| SMILES | CC(S)CCS |
| InChI | InChI=1S/C4H10S2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3 |
| InChIKey | XMEPRJBZFCWFKN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,3-dithiol?
The IUPAC name of butane-1,3-dithiol (CID 520119) is butane-1,3-dithiol.
What is the SMILES notation for butane-1,3-dithiol?
The canonical SMILES for butane-1,3-dithiol is CC(S)CCS.
What is the InChIKey of butane-1,3-dithiol?
The InChIKey is XMEPRJBZFCWFKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10S2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3.
What are the key properties of butane-1,3-dithiol?
butane-1,3-dithiol has a molecular weight of 122.26 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,3-dithiol is sourced from PubChem (CID 520119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).