C6H14S4 — CID 57180046
hexane-1,3,4,6-tetrathiol (PubChem CID 57180046) has the molecular formula C6H14S4 and a molecular weight of 214.45 g/mol. Its IUPAC name is hexane-1,3,4,6-tetrathiol.
| Compound Name | hexane-1,3,4,6-tetrathiol |
|---|---|
| PubChem CID | 57180046 |
| Molecular Formula | C6H14S4 |
| Molecular Weight | 214.45 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | hexane-1,3,4,6-tetrathiol |
| SMILES | SCCC(S)C(S)CCS |
| InChI | InChI=1S/C6H14S4/c7-3-1-5(9)6(10)2-4-8/h5-10H,1-4H2 |
| InChIKey | OTBCNPBQVAYHHC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|