C11H24O3S2 — CID 141481744
1,11-bis(sulfanyl)undecane-3,6,9-triol (PubChem CID 141481744) has the molecular formula C11H24O3S2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1,11-bis(sulfanyl)undecane-3,6,9-triol.
| Compound Name | 1,11-bis(sulfanyl)undecane-3,6,9-triol |
|---|---|
| PubChem CID | 141481744 |
| Molecular Formula | C11H24O3S2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1,11-bis(sulfanyl)undecane-3,6,9-triol |
| SMILES | OC(CCS)CCC(O)CCC(O)CCS |
| InChI | InChI=1S/C11H24O3S2/c12-9(1-3-10(13)5-7-15)2-4-11(14)6-8-16/h9-16H,1-8H2 |
| InChIKey | FGHWVUPBMLIRIU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|