C11H24S4 — CID 57041789
undecane-1,4,8,11-tetrathiol (PubChem CID 57041789) has the molecular formula C11H24S4 and a molecular weight of 284.58 g/mol. Its IUPAC name is undecane-1,4,8,11-tetrathiol.
| Compound Name | undecane-1,4,8,11-tetrathiol |
|---|---|
| PubChem CID | 57041789 |
| Molecular Formula | C11H24S4 |
| Molecular Weight | 284.58 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | undecane-1,4,8,11-tetrathiol |
| SMILES | SCCCC(S)CCCC(S)CCCS |
| InChI | InChI=1S/C11H24S4/c12-8-2-6-10(14)4-1-5-11(15)7-3-9-13/h10-15H,1-9H2 |
| InChIKey | JEQBIHHRICQTST-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|