C16H34OS4 — CID 21488227
8-[2,8-bis(sulfanyl)octoxy]octane-1,7-dithiol (PubChem CID 21488227) has the molecular formula C16H34OS4 and a molecular weight of 370.72 g/mol. Its IUPAC name is 8-[2,8-bis(sulfanyl)octoxy]octane-1,7-dithiol.
| Compound Name | 8-[2,8-bis(sulfanyl)octoxy]octane-1,7-dithiol |
|---|---|
| PubChem CID | 21488227 |
| Molecular Formula | C16H34OS4 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 8-[2,8-bis(sulfanyl)octoxy]octane-1,7-dithiol |
| SMILES | SCCCCCCC(S)COCC(S)CCCCCCS |
| InChI | InChI=1S/C16H34OS4/c18-11-7-3-1-5-9-15(20)13-17-14-16(21)10-6-2-4-8-12-19/h15-16,18-21H,1-14H2 |
| InChIKey | RBNLJCOVMCUCOG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|