C6H14OS4 — CID 20502926
3-[2,3-bis(sulfanyl)propoxy]propane-1,2-dithiol (PubChem CID 20502926) has the molecular formula C6H14OS4 and a molecular weight of 230.44 g/mol. Its IUPAC name is 3-[2,3-bis(sulfanyl)propoxy]propane-1,2-dithiol.
| Compound Name | 3-[2,3-bis(sulfanyl)propoxy]propane-1,2-dithiol |
|---|---|
| PubChem CID | 20502926 |
| Molecular Formula | C6H14OS4 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 3-[2,3-bis(sulfanyl)propoxy]propane-1,2-dithiol |
| SMILES | SCC(S)COCC(S)CS |
| InChI | InChI=1S/C6H14OS4/c8-3-5(10)1-7-2-6(11)4-9/h5-6,8-11H,1-4H2 |
| InChIKey | BMSBPGZQJSNNSA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|