C3H9NS2 — CID 54490245
3-aminopropane-1,2-dithiol (PubChem CID 54490245) has the molecular formula C3H9NS2 and a molecular weight of 123.25 g/mol. Its IUPAC name is 3-aminopropane-1,2-dithiol.
| Compound Name | 3-aminopropane-1,2-dithiol |
|---|---|
| PubChem CID | 54490245 |
| Molecular Formula | C3H9NS2 |
| Molecular Weight | 123.25 g/mol |
| Exact Mass | 123.02 |
| IUPAC Name | 3-aminopropane-1,2-dithiol |
| SMILES | NCC(S)CS |
| InChI | InChI=1S/C3H9NS2/c4-1-3(6)2-5/h3,5-6H,1-2,4H2 |
| InChIKey | XVEUMDGQLIUQAE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|