C6H12O3S3 — CID 174834058
2,3-bis(sulfanyl)propyl 3-hydroxy-3-sulfanylpropanoate (PubChem CID 174834058) has the molecular formula C6H12O3S3 and a molecular weight of 228.36 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)propyl 3-hydroxy-3-sulfanylpropanoate.
| Compound Name | 2,3-bis(sulfanyl)propyl 3-hydroxy-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 174834058 |
| Molecular Formula | C6H12O3S3 |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 2,3-bis(sulfanyl)propyl 3-hydroxy-3-sulfanylpropanoate |
| SMILES | O=C(CC(O)S)OCC(S)CS |
| InChI | InChI=1S/C6H12O3S3/c7-5(1-6(8)12)9-2-4(11)3-10/h4,6,8,10-12H,1-3H2 |
| InChIKey | WSFACQAPLHRIOP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|