C21H40O8S4 — CID 157202459
2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate;methyl 3-sulfanylpropanoate (PubChem CID 157202459) has the molecular formula C21H40O8S4 and a molecular weight of 548.81 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate;methyl 3-sulfanylpropanoate.
| Compound Name | 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate;methyl 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 157202459 |
| Molecular Formula | C21H40O8S4 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2,3-bis(sulfanyl)propyl 2-(2-methoxyethoxy)acetate;cyclohexyl 3-sulfanylpropanoate;methyl 3-sulfanylpropanoate |
| SMILES | COC(=O)CCS.COCCOCC(=O)OCC(S)CS.O=C(CCS)OC1CCCCC1 |
| InChI | InChI=1S/C9H16O2S.C8H16O4S2.C4H8O2S/c10-9(6-7-12)11-8-4-2-1-3-5-8;1-10-2-3-11-5-8(9)12-4-7(14)6-13;1-6-4(5)2-3-7/h8,12H,1-7H2;7,13-14H,2-6H2,1H3;7H,2-3H2,1H3 |
| InChIKey | AQYMRUXIDTYVMF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|