About cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate
cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate (PubChem CID 160610074) has the molecular formula C18H34O6S2
and a molecular weight of 410.60 g/mol. Its IUPAC name is cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate.
Molecular Properties
| Compound Name | cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate |
| PubChem CID | 160610074 |
| Molecular Formula | C18H34O6S2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate |
| SMILES | CCC(S)C(=O)OCCOCCOC.O=C(CCS)OC1CCCCC1 |
| InChI | InChI=1S/C9H18O4S.C9H16O2S/c1-3-8(14)9(10)13-7-6-12-5-4-11-2;10-9(6-7-12)11-8-4-2-1-3-5-8/h8,14H,3-7H2,1-2H3;8,12H,1-7H2 |
| InChIKey | RFJZOLFASHNQTM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate?
The IUPAC name of cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate (CID 160610074) is cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate.
What is the SMILES notation for cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate?
The canonical SMILES for cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate is CCC(S)C(=O)OCCOCCOC.O=C(CCS)OC1CCCCC1.
What is the InChIKey of cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate?
The InChIKey is RFJZOLFASHNQTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S.C9H16O2S/c1-3-8(14)9(10)13-7-6-12-5-4-11-2;10-9(6-7-12)11-8-4-2-1-3-5-8/h8,14H,3-7H2,1-2H3;8,12H,1-7H2.
What are the key properties of cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate?
cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate has a molecular weight of 410.60 g/mol, XLogP of 3.08, 11 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 3-sulfanylpropanoate;2-(2-methoxyethoxy)ethyl 2-sulfanylbutanoate is sourced from PubChem (CID 160610074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).